சுருக்கம்

Preparation and metal uptake capacity of pentaaza-macrocyclic polysiloxane immobilized ligand system

Nizam M.El-Ashgar, Monzir S.Abdel-Latif

Insoluble porous solid macrocyclic 1,4,7,10,13-pentaazapentadecane-3,14- dione-1-propyl-N-propyl polysiloxane ligand systemof the general formula P-(CH2)3-NH-(CH2)3-C8H22O2N3, (where P represents [Si-O]n siloxane network) has been prepared by the reaction of macro-silane agent with tetraethyl orthosilicate. Themacro-silane agentwas prepared by the reaction of iminobis (N-2-aminoethylacetamide) ligandwith 3-iodopropyltrimethoxysilane in 1:3 molar ratio respectively. The new prepared polysiloxane system exhibits high potential for the uptake of metal ions (Fe3+, Co2+, Ni2+, Cu2+, Zn2+,Ag+, Cd2+, Hg2+ and Pb2+). Chemisorption of the metal ions by the ligand system at the optimum conditions was found in the order: Ag +Pb2+  Hg2+  Cu2+  Ni2+  Fe3+  Co2+> Cd2+>Zn2+.